C26H31N6O11+ — CID 20775435
buta-1,3-diynylperoxy-[4-[5-carbamoyl-11-(2-carboxyethyl)-16-nitro-7,10,13-trioxo-2-oxa-6,9,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-trien-8-yl]butyl]azanium (PubChem CID 20775435) has the molecular formula C26H31N6O11+ and a molecular weight of 603.57 g/mol. Its IUPAC name is buta-1,3-diynylperoxy-[4-[5-carbamoyl-11-(2-carboxyethyl)-16-nitro-7,10,13-trioxo-2-oxa-6,9,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-trien-8-yl]butyl]azanium.
| Compound Name | buta-1,3-diynylperoxy-[4-[5-carbamoyl-11-(2-carboxyethyl)-16-nitro-7,10,13-trioxo-2-oxa-6,9,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-trien-8-yl]butyl]azanium |
|---|---|
| PubChem CID | 20775435 |
| Molecular Formula | C26H31N6O11+ |
| Molecular Weight | 603.57 g/mol |
| Exact Mass | 603.20 |
| IUPAC Name | buta-1,3-diynylperoxy-[4-[5-carbamoyl-11-(2-carboxyethyl)-16-nitro-7,10,13-trioxo-2-oxa-6,9,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-trien-8-yl]butyl]azanium |
| SMILES | C#CC#COO[NH2+]CCCCC1NC(=O)C(CCC(=O)O)NC(=O)c2cc([N+](=O)[O-])ccc2OCCC(C(N)=O)NC1=O |
| InChI | InChI=1S/C26H30N6O11/c1-2-3-13-42-43-28-12-5-4-6-19-25(37)29-18(23(27)35)11-14-41-21-9-7-16(32(39)40)15-17(21)24(36)30-20(26(38)31-19)8-10-22(33)34/h1,7,9,15,18-20,28H,4-6,8,10-12,14H2,(H2,27,35)(H,29,37)(H,30,36)(H,31,38)(H,33,34)/p+1 |
| InChIKey | XULHXIITCXELNL-UHFFFAOYSA-O |
| XLogP | -2.01 |
| TPSA | 255.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.57 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|