C10H9N3O5S — CID 103894405
N-(2-hydroxy-5-nitrophenyl)-2-oxo-1,3-thiazolidine-4-carboxamide (PubChem CID 103894405) has the molecular formula C10H9N3O5S and a molecular weight of 283.26 g/mol. Its IUPAC name is N-(2-hydroxy-5-nitrophenyl)-2-oxo-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(2-hydroxy-5-nitrophenyl)-2-oxo-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 103894405 |
| Molecular Formula | C10H9N3O5S |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | N-(2-hydroxy-5-nitrophenyl)-2-oxo-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C1NC(C(=O)Nc2cc([N+](=O)[O-])ccc2O)CS1 |
| InChI | InChI=1S/C10H9N3O5S/c14-8-2-1-5(13(17)18)3-6(8)11-9(15)7-4-19-10(16)12-7/h1-3,7,14H,4H2,(H,11,15)(H,12,16) |
| InChIKey | HHNIZHSSMQJDPX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|