C14H9N3O4 — CID 3128964
3-nitro-5,12-dihydrobenzo[c][1,6]benzodiazocine-6,11-dione (PubChem CID 3128964) has the molecular formula C14H9N3O4 and a molecular weight of 283.24 g/mol. Its IUPAC name is 3-nitro-5,12-dihydrobenzo[c][1,6]benzodiazocine-6,11-dione.
| Compound Name | 3-nitro-5,12-dihydrobenzo[c][1,6]benzodiazocine-6,11-dione |
|---|---|
| PubChem CID | 3128964 |
| Molecular Formula | C14H9N3O4 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 3-nitro-5,12-dihydrobenzo[c][1,6]benzodiazocine-6,11-dione |
| SMILES | O=C1Nc2ccc([N+](=O)[O-])cc2NC(=O)c2ccccc21 |
| InChI | InChI=1S/C14H9N3O4/c18-13-9-3-1-2-4-10(9)14(19)16-12-7-8(17(20)21)5-6-11(12)15-13/h1-7H,(H,15,18)(H,16,19) |
| InChIKey | NUKBMCJYIMGHGT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|