C20H16N4O5S — CID 56952197
N-[5-nitro-2-(6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-9-yl)phenyl]methanesulfonamide (PubChem CID 56952197) has the molecular formula C20H16N4O5S and a molecular weight of 424.44 g/mol. Its IUPAC name is N-[5-nitro-2-(6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-9-yl)phenyl]methanesulfonamide.
| Compound Name | N-[5-nitro-2-(6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-9-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 56952197 |
| Molecular Formula | C20H16N4O5S |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | N-[5-nitro-2-(6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-9-yl)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc([N+](=O)[O-])ccc1-c1ccc2c(c1)Nc1ccccc1NC2=O |
| InChI | InChI=1S/C20H16N4O5S/c1-30(28,29)23-19-11-13(24(26)27)7-9-14(19)12-6-8-15-18(10-12)21-16-4-2-3-5-17(16)22-20(15)25/h2-11,21,23H,1H3,(H,22,25) |
| InChIKey | IXFZTAQJBHJHBM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|