C19H16N4O6S — CID 55662991
N-[2-(2-hydroxyethylamino)-5-nitrophenyl]-2-oxo-1H-benzo[cd]indole-6-sulfonamide (PubChem CID 55662991) has the molecular formula C19H16N4O6S and a molecular weight of 428.43 g/mol. Its IUPAC name is N-[2-(2-hydroxyethylamino)-5-nitrophenyl]-2-oxo-1H-benzo[cd]indole-6-sulfonamide.
| Compound Name | N-[2-(2-hydroxyethylamino)-5-nitrophenyl]-2-oxo-1H-benzo[cd]indole-6-sulfonamide |
|---|---|
| PubChem CID | 55662991 |
| Molecular Formula | C19H16N4O6S |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | N-[2-(2-hydroxyethylamino)-5-nitrophenyl]-2-oxo-1H-benzo[cd]indole-6-sulfonamide |
| SMILES | O=C1Nc2ccc(S(=O)(=O)Nc3cc([N+](=O)[O-])ccc3NCCO)c3cccc1c23 |
| InChI | InChI=1S/C19H16N4O6S/c24-9-8-20-14-5-4-11(23(26)27)10-16(14)22-30(28,29)17-7-6-15-18-12(17)2-1-3-13(18)19(25)21-15/h1-7,10,20,22,24H,8-9H2,(H,21,25) |
| InChIKey | PRPUAVXHFAGJDS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 150.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|