C17H14N4O5S2 — CID 55896537
2-oxo-N-[3-(sulfamoylamino)phenyl]-1H-benzo[cd]indole-6-sulfonamide (PubChem CID 55896537) has the molecular formula C17H14N4O5S2 and a molecular weight of 418.46 g/mol. Its IUPAC name is 2-oxo-N-[3-(sulfamoylamino)phenyl]-1H-benzo[cd]indole-6-sulfonamide.
| Compound Name | 2-oxo-N-[3-(sulfamoylamino)phenyl]-1H-benzo[cd]indole-6-sulfonamide |
|---|---|
| PubChem CID | 55896537 |
| Molecular Formula | C17H14N4O5S2 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | 2-oxo-N-[3-(sulfamoylamino)phenyl]-1H-benzo[cd]indole-6-sulfonamide |
| SMILES | NS(=O)(=O)Nc1cccc(NS(=O)(=O)c2ccc3c4c(cccc24)C(=O)N3)c1 |
| InChI | InChI=1S/C17H14N4O5S2/c18-28(25,26)21-11-4-1-3-10(9-11)20-27(23,24)15-8-7-14-16-12(15)5-2-6-13(16)17(22)19-14/h1-9,20-21H,(H,19,22)(H2,18,25,26) |
| InChIKey | LTTWIZXLGAYQNK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 147.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |