C23H17N3O5S2 — CID 55662957
2-oxo-N-[4-(phenylsulfamoyl)phenyl]-1H-benzo[cd]indole-6-sulfonamide (PubChem CID 55662957) has the molecular formula C23H17N3O5S2 and a molecular weight of 479.54 g/mol. Its IUPAC name is 2-oxo-N-[4-(phenylsulfamoyl)phenyl]-1H-benzo[cd]indole-6-sulfonamide.
| Compound Name | 2-oxo-N-[4-(phenylsulfamoyl)phenyl]-1H-benzo[cd]indole-6-sulfonamide |
|---|---|
| PubChem CID | 55662957 |
| Molecular Formula | C23H17N3O5S2 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | 2-oxo-N-[4-(phenylsulfamoyl)phenyl]-1H-benzo[cd]indole-6-sulfonamide |
| SMILES | O=C1Nc2ccc(S(=O)(=O)Nc3ccc(S(=O)(=O)Nc4ccccc4)cc3)c3cccc1c23 |
| InChI | InChI=1S/C23H17N3O5S2/c27-23-19-8-4-7-18-21(14-13-20(24-23)22(18)19)33(30,31)26-16-9-11-17(12-10-16)32(28,29)25-15-5-2-1-3-6-15/h1-14,25-26H,(H,24,27) |
| InChIKey | VUEOSHGSPHHWFI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |