C23H25N3O5S2 — CID 55895798
N-[5-(diethylsulfamoyl)-2,3-dimethylphenyl]-2-oxo-1H-benzo[cd]indole-6-sulfonamide (PubChem CID 55895798) has the molecular formula C23H25N3O5S2 and a molecular weight of 487.60 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2,3-dimethylphenyl]-2-oxo-1H-benzo[cd]indole-6-sulfonamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2,3-dimethylphenyl]-2-oxo-1H-benzo[cd]indole-6-sulfonamide |
|---|---|
| PubChem CID | 55895798 |
| Molecular Formula | C23H25N3O5S2 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2,3-dimethylphenyl]-2-oxo-1H-benzo[cd]indole-6-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C)c(C)c(NS(=O)(=O)c2ccc3c4c(cccc24)C(=O)N3)c1 |
| InChI | InChI=1S/C23H25N3O5S2/c1-5-26(6-2)33(30,31)16-12-14(3)15(4)20(13-16)25-32(28,29)21-11-10-19-22-17(21)8-7-9-18(22)23(27)24-19/h7-13,25H,5-6H2,1-4H3,(H,24,27) |
| InChIKey | YMQFORPFUHRIOG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |