C14H10N3O6- — CID 135720694
2-(furan-2-yl)-2-hydroxy-1-(7-nitro-3-oxo-1,4-dihydroquinoxalin-2-ylidene)ethanolate (PubChem CID 135720694) has the molecular formula C14H10N3O6- and a molecular weight of 316.25 g/mol. Its IUPAC name is 2-(furan-2-yl)-2-hydroxy-1-(7-nitro-3-oxo-1,4-dihydroquinoxalin-2-ylidene)ethanolate.
| Compound Name | 2-(furan-2-yl)-2-hydroxy-1-(7-nitro-3-oxo-1,4-dihydroquinoxalin-2-ylidene)ethanolate |
|---|---|
| PubChem CID | 135720694 |
| Molecular Formula | C14H10N3O6- |
| Molecular Weight | 316.25 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 2-(furan-2-yl)-2-hydroxy-1-(7-nitro-3-oxo-1,4-dihydroquinoxalin-2-ylidene)ethanolate |
| SMILES | O=C1Nc2ccc([N+](=O)[O-])cc2NC1=C([O-])C(O)c1ccco1 |
| InChI | InChI=1S/C14H11N3O6/c18-12(10-2-1-5-23-10)13(19)11-14(20)16-8-4-3-7(17(21)22)6-9(8)15-11/h1-6,12,15,18-19H,(H,16,20)/p-1 |
| InChIKey | SOZLBTUNTGAFGA-UHFFFAOYSA-M |
| XLogP | 0.86 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|