C16H16N5O5- — CID 135801154
3-[1-(2,2-dimethylhydrazinyl)-2-(furan-2-yl)-2-hydroxyethylidene]-7-nitro-4H-quinoxalin-2-olate (PubChem CID 135801154) has the molecular formula C16H16N5O5- and a molecular weight of 358.33 g/mol. Its IUPAC name is 3-[1-(2,2-dimethylhydrazinyl)-2-(furan-2-yl)-2-hydroxyethylidene]-7-nitro-4H-quinoxalin-2-olate.
| Compound Name | 3-[1-(2,2-dimethylhydrazinyl)-2-(furan-2-yl)-2-hydroxyethylidene]-7-nitro-4H-quinoxalin-2-olate |
|---|---|
| PubChem CID | 135801154 |
| Molecular Formula | C16H16N5O5- |
| Molecular Weight | 358.33 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 3-[1-(2,2-dimethylhydrazinyl)-2-(furan-2-yl)-2-hydroxyethylidene]-7-nitro-4H-quinoxalin-2-olate |
| SMILES | CN(C)NC(=C1Nc2ccc([N+](=O)[O-])cc2N=C1[O-])C(O)c1ccco1 |
| InChI | InChI=1S/C16H17N5O5/c1-20(2)19-13(15(22)12-4-3-7-26-12)14-16(23)18-11-8-9(21(24)25)5-6-10(11)17-14/h3-8,15,17,19,22H,1-2H3,(H,18,23)/p-1 |
| InChIKey | NHRWJTMTINGAQP-UHFFFAOYSA-M |
| XLogP | 1.01 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|