C24H22N6O10 — CID 11979462
ethyl (2E)-2-(6-nitro-3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetate;ethyl (2E)-2-(7-nitro-3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetate (PubChem CID 11979462) has the molecular formula C24H22N6O10 and a molecular weight of 554.47 g/mol. Its IUPAC name is ethyl (2E)-2-(6-nitro-3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetate;ethyl (2E)-2-(7-nitro-3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetate.
| Compound Name | ethyl (2E)-2-(6-nitro-3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetate;ethyl (2E)-2-(7-nitro-3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetate |
|---|---|
| PubChem CID | 11979462 |
| Molecular Formula | C24H22N6O10 |
| Molecular Weight | 554.47 g/mol |
| Exact Mass | 554.14 |
| IUPAC Name | ethyl (2E)-2-(6-nitro-3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetate;ethyl (2E)-2-(7-nitro-3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetate |
| SMILES | CCOC(=O)/C=C1/Nc2cc([N+](=O)[O-])ccc2NC1=O.CCOC(=O)/C=C1/Nc2ccc([N+](=O)[O-])cc2NC1=O |
| InChI | InChI=1S/2C12H11N3O5/c1-2-20-11(16)6-10-12(17)14-8-4-3-7(15(18)19)5-9(8)13-10;1-2-20-11(16)6-10-12(17)14-9-5-7(15(18)19)3-4-8(9)13-10/h2*3-6,13H,2H2,1H3,(H,14,17)/b2*10-6+ |
| InChIKey | HCABLNIXSJNPOO-BKJYBGOFSA-N |
| XLogP | 2.81 |
| TPSA | 221.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|