C13H13NO5 — CID 70051068
ethyl (2Z)-2-(6-nitro-4H-chromen-3-ylidene)acetate (PubChem CID 70051068) has the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. Its IUPAC name is ethyl (2Z)-2-(6-nitro-4H-chromen-3-ylidene)acetate.
| Compound Name | ethyl (2Z)-2-(6-nitro-4H-chromen-3-ylidene)acetate |
|---|---|
| PubChem CID | 70051068 |
| Molecular Formula | C13H13NO5 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | ethyl (2Z)-2-(6-nitro-4H-chromen-3-ylidene)acetate |
| SMILES | CCOC(=O)/C=C1\COc2ccc([N+](=O)[O-])cc2C1 |
| InChI | InChI=1S/C13H13NO5/c1-2-18-13(15)6-9-5-10-7-11(14(16)17)3-4-12(10)19-8-9/h3-4,6-7H,2,5,8H2,1H3/b9-6- |
| InChIKey | UYDLZGTWLKTJGU-TWGQIWQCSA-N |
| XLogP | 2.02 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|