C8H6N4O3 — CID 163552280
6-nitro-1a,3-dihydro-1H-diazirino[1,3-a]quinoxalin-2-one (PubChem CID 163552280) has the molecular formula C8H6N4O3 and a molecular weight of 206.16 g/mol. Its IUPAC name is 6-nitro-1a,3-dihydro-1H-diazirino[1,3-a]quinoxalin-2-one.
| Compound Name | 6-nitro-1a,3-dihydro-1H-diazirino[1,3-a]quinoxalin-2-one |
|---|---|
| PubChem CID | 163552280 |
| Molecular Formula | C8H6N4O3 |
| Molecular Weight | 206.16 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 6-nitro-1a,3-dihydro-1H-diazirino[1,3-a]quinoxalin-2-one |
| SMILES | O=C1Nc2ccc([N+](=O)[O-])cc2N2NC12 |
| InChI | InChI=1S/C8H6N4O3/c13-8-7-10-11(7)6-3-4(12(14)15)1-2-5(6)9-8/h1-3,7,10H,(H,9,13) |
| InChIKey | FKBSQINRVHIAMQ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.16 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|