C20H14BrN3O3 — CID 155338349
5-benzyl-8-bromo-3-nitro-11H-benzo[b][1,4]benzodiazepin-6-one (PubChem CID 155338349) has the molecular formula C20H14BrN3O3 and a molecular weight of 424.25 g/mol. Its IUPAC name is 5-benzyl-8-bromo-3-nitro-11H-benzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 5-benzyl-8-bromo-3-nitro-11H-benzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 155338349 |
| Molecular Formula | C20H14BrN3O3 |
| Molecular Weight | 424.25 g/mol |
| Exact Mass | 423.02 |
| IUPAC Name | 5-benzyl-8-bromo-3-nitro-11H-benzo[b][1,4]benzodiazepin-6-one |
| SMILES | O=C1c2cc(Br)ccc2Nc2ccc([N+](=O)[O-])cc2N1Cc1ccccc1 |
| InChI | InChI=1S/C20H14BrN3O3/c21-14-6-8-17-16(10-14)20(25)23(12-13-4-2-1-3-5-13)19-11-15(24(26)27)7-9-18(19)22-17/h1-11,22H,12H2 |
| InChIKey | IUNUIUQBNSQWOT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.25 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|