C19H19N5O3 — CID 135412395
3-(4-benzylpiperazin-1-yl)imino-5-nitro-1H-indol-2-one (PubChem CID 135412395) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is 3-(4-benzylpiperazin-1-yl)imino-5-nitro-1H-indol-2-one.
| Compound Name | 3-(4-benzylpiperazin-1-yl)imino-5-nitro-1H-indol-2-one |
|---|---|
| PubChem CID | 135412395 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 3-(4-benzylpiperazin-1-yl)imino-5-nitro-1H-indol-2-one |
| SMILES | O=C1Nc2ccc([N+](=O)[O-])cc2C1=NN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H19N5O3/c25-19-18(16-12-15(24(26)27)6-7-17(16)20-19)21-23-10-8-22(9-11-23)13-14-4-2-1-3-5-14/h1-7,12H,8-11,13H2,(H,20,21,25) |
| InChIKey | OYGMDWOHIXABFT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 91.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|