C17H14N2O5 — CID 142598896
1'-benzyl-5'-nitrospiro[1,3-dioxolane-2,3'-indole]-2'-one (PubChem CID 142598896) has the molecular formula C17H14N2O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is 1'-benzyl-5'-nitrospiro[1,3-dioxolane-2,3'-indole]-2'-one.
| Compound Name | 1'-benzyl-5'-nitrospiro[1,3-dioxolane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 142598896 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 1'-benzyl-5'-nitrospiro[1,3-dioxolane-2,3'-indole]-2'-one |
| SMILES | O=C1N(Cc2ccccc2)c2ccc([N+](=O)[O-])cc2C12OCCO2 |
| InChI | InChI=1S/C17H14N2O5/c20-16-17(23-8-9-24-17)14-10-13(19(21)22)6-7-15(14)18(16)11-12-4-2-1-3-5-12/h1-7,10H,8-9,11H2 |
| InChIKey | ORJDOLXBWKGWLG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|