C12H10NO5- — CID 1247232
2-(2'-oxospiro[1,3-dioxolane-2,3'-indole]-1'-yl)acetate (PubChem CID 1247232) has the molecular formula C12H10NO5- and a molecular weight of 248.21 g/mol. Its IUPAC name is 2-(2'-oxospiro[1,3-dioxolane-2,3'-indole]-1'-yl)acetate.
| Compound Name | 2-(2'-oxospiro[1,3-dioxolane-2,3'-indole]-1'-yl)acetate |
|---|---|
| PubChem CID | 1247232 |
| Molecular Formula | C12H10NO5- |
| Molecular Weight | 248.21 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 2-(2'-oxospiro[1,3-dioxolane-2,3'-indole]-1'-yl)acetate |
| SMILES | O=C([O-])CN1C(=O)C2(OCCO2)c2ccccc21 |
| InChI | InChI=1S/C12H11NO5/c14-10(15)7-13-9-4-2-1-3-8(9)12(11(13)16)17-5-6-18-12/h1-4H,5-7H2,(H,14,15)/p-1 |
| InChIKey | ATVACOHMLILXBK-UHFFFAOYSA-M |
| XLogP | -1.02 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.21 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |