C17H21N3O7 — CID 17370126
5-(hydroxymethyl)-1'-(morpholin-4-ylmethyl)-5-nitrospiro[1,3-dioxane-2,3'-indole]-2'-one (PubChem CID 17370126) has the molecular formula C17H21N3O7 and a molecular weight of 379.37 g/mol. Its IUPAC name is 5-(hydroxymethyl)-1'-(morpholin-4-ylmethyl)-5-nitrospiro[1,3-dioxane-2,3'-indole]-2'-one.
| Compound Name | 5-(hydroxymethyl)-1'-(morpholin-4-ylmethyl)-5-nitrospiro[1,3-dioxane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 17370126 |
| Molecular Formula | C17H21N3O7 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 5-(hydroxymethyl)-1'-(morpholin-4-ylmethyl)-5-nitrospiro[1,3-dioxane-2,3'-indole]-2'-one |
| SMILES | O=C1N(CN2CCOCC2)c2ccccc2C12OCC(CO)([N+](=O)[O-])CO2 |
| InChI | InChI=1S/C17H21N3O7/c21-9-16(20(23)24)10-26-17(27-11-16)13-3-1-2-4-14(13)19(15(17)22)12-18-5-7-25-8-6-18/h1-4,21H,5-12H2 |
| InChIKey | GAAKDZLZUCMYGP-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 114.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|