C24H30N4O6+2 — CID 4168687
1'-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-5-(hydroxymethyl)-5-nitrospiro[1,3-dioxane-2,3'-indole]-2'-one (PubChem CID 4168687) has the molecular formula C24H30N4O6+2 and a molecular weight of 470.53 g/mol. Its IUPAC name is 1'-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-5-(hydroxymethyl)-5-nitrospiro[1,3-dioxane-2,3'-indole]-2'-one.
| Compound Name | 1'-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-5-(hydroxymethyl)-5-nitrospiro[1,3-dioxane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 4168687 |
| Molecular Formula | C24H30N4O6+2 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 1'-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-5-(hydroxymethyl)-5-nitrospiro[1,3-dioxane-2,3'-indole]-2'-one |
| SMILES | O=C1N(C[NH+]2CC[NH+](Cc3ccccc3)CC2)c2ccccc2C12OCC(CO)([N+](=O)[O-])CO2 |
| InChI | InChI=1S/C24H28N4O6/c29-15-23(28(31)32)16-33-24(34-17-23)20-8-4-5-9-21(20)27(22(24)30)18-26-12-10-25(11-13-26)14-19-6-2-1-3-7-19/h1-9,29H,10-18H2/p+2 |
| InChIKey | PBOKRZHQJBENGK-UHFFFAOYSA-P |
| XLogP | -1.82 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|