C21H22ClN2O3+ — CID 7277271
(2R,4R)-4-(chloromethyl)-1'-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)spiro[1,3-dioxolane-2,3'-indole]-2'-one (PubChem CID 7277271) has the molecular formula C21H22ClN2O3+ and a molecular weight of 385.87 g/mol. Its IUPAC name is (2R,4R)-4-(chloromethyl)-1'-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)spiro[1,3-dioxolane-2,3'-indole]-2'-one.
| Compound Name | (2R,4R)-4-(chloromethyl)-1'-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)spiro[1,3-dioxolane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 7277271 |
| Molecular Formula | C21H22ClN2O3+ |
| Molecular Weight | 385.87 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | (2R,4R)-4-(chloromethyl)-1'-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)spiro[1,3-dioxolane-2,3'-indole]-2'-one |
| SMILES | O=C1N(C[NH+]2CCc3ccccc3C2)c2ccccc2[C@]12OC[C@H](CCl)O2 |
| InChI | InChI=1S/C21H21ClN2O3/c22-11-17-13-26-21(27-17)18-7-3-4-8-19(18)24(20(21)25)14-23-10-9-15-5-1-2-6-16(15)12-23/h1-8,17H,9-14H2/p+1/t17-,21+/m0/s1 |
| InChIKey | XEDFTGXKVQWEPB-LAUBAEHRSA-O |
| XLogP | 1.44 |
| TPSA | 43.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.87 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|