C18H15Cl2N2O2+ — CID 7479861
5,6-dichloro-2-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)isoindole-1,3-dione (PubChem CID 7479861) has the molecular formula C18H15Cl2N2O2+ and a molecular weight of 362.24 g/mol. Its IUPAC name is 5,6-dichloro-2-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)isoindole-1,3-dione.
| Compound Name | 5,6-dichloro-2-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 7479861 |
| Molecular Formula | C18H15Cl2N2O2+ |
| Molecular Weight | 362.24 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 5,6-dichloro-2-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)isoindole-1,3-dione |
| SMILES | O=C1c2cc(Cl)c(Cl)cc2C(=O)N1C[NH+]1CCc2ccccc2C1 |
| InChI | InChI=1S/C18H14Cl2N2O2/c19-15-7-13-14(8-16(15)20)18(24)22(17(13)23)10-21-6-5-11-3-1-2-4-12(11)9-21/h1-4,7-8H,5-6,9-10H2/p+1 |
| InChIKey | MKYXFDGHTKUJQQ-UHFFFAOYSA-O |
| XLogP | 2.19 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|