C29H30ClN3O3 — CID 51629115
(2R,4R)-1'-[(4-benzhydrylpiperazin-1-yl)methyl]-4-(chloromethyl)spiro[1,3-dioxolane-2,3'-indole]-2'-one (PubChem CID 51629115) has the molecular formula C29H30ClN3O3 and a molecular weight of 504.03 g/mol. Its IUPAC name is (2R,4R)-1'-[(4-benzhydrylpiperazin-1-yl)methyl]-4-(chloromethyl)spiro[1,3-dioxolane-2,3'-indole]-2'-one.
| Compound Name | (2R,4R)-1'-[(4-benzhydrylpiperazin-1-yl)methyl]-4-(chloromethyl)spiro[1,3-dioxolane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 51629115 |
| Molecular Formula | C29H30ClN3O3 |
| Molecular Weight | 504.03 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | (2R,4R)-1'-[(4-benzhydrylpiperazin-1-yl)methyl]-4-(chloromethyl)spiro[1,3-dioxolane-2,3'-indole]-2'-one |
| SMILES | O=C1N(CN2CCN(C(c3ccccc3)c3ccccc3)CC2)c2ccccc2[C@]12OC[C@H](CCl)O2 |
| InChI | InChI=1S/C29H30ClN3O3/c30-19-24-20-35-29(36-24)25-13-7-8-14-26(25)33(28(29)34)21-31-15-17-32(18-16-31)27(22-9-3-1-4-10-22)23-11-5-2-6-12-23/h1-14,24,27H,15-21H2/t24-,29+/m0/s1 |
| InChIKey | YFNMJQKROMYEOY-PWUYWRBVSA-N |
| XLogP | 4.20 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.03 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|