C23H24ClN3O3 — CID 17138660
1'-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]spiro[4,7-dihydro-1,3-dioxepine-2,3'-indole]-2'-one (PubChem CID 17138660) has the molecular formula C23H24ClN3O3 and a molecular weight of 425.92 g/mol. Its IUPAC name is 1'-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]spiro[4,7-dihydro-1,3-dioxepine-2,3'-indole]-2'-one.
| Compound Name | 1'-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]spiro[4,7-dihydro-1,3-dioxepine-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 17138660 |
| Molecular Formula | C23H24ClN3O3 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 1'-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]spiro[4,7-dihydro-1,3-dioxepine-2,3'-indole]-2'-one |
| SMILES | O=C1N(CN2CCN(c3cccc(Cl)c3)CC2)c2ccccc2C12OCC=CCO2 |
| InChI | InChI=1S/C23H24ClN3O3/c24-18-6-5-7-19(16-18)26-12-10-25(11-13-26)17-27-21-9-2-1-8-20(21)23(22(27)28)29-14-3-4-15-30-23/h1-9,16H,10-15,17H2 |
| InChIKey | ZPLINVLUSLFSDM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|