About 1'-[(4-benzhydrylpiperazin-1-yl)methyl]spiro[1,3-dioxepane-2,3'-indole]-2'-one
1'-[(4-benzhydrylpiperazin-1-yl)methyl]spiro[1,3-dioxepane-2,3'-indole]-2'-one (PubChem CID 2001450) has the molecular formula C30H33N3O3
and a molecular weight of 483.61 g/mol. Its IUPAC name is 1'-[(4-benzhydrylpiperazin-1-yl)methyl]spiro[1,3-dioxepane-2,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 1'-[(4-benzhydrylpiperazin-1-yl)methyl]spiro[1,3-dioxepane-2,3'-indole]-2'-one |
| PubChem CID | 2001450 |
| Molecular Formula | C30H33N3O3 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | 1'-[(4-benzhydrylpiperazin-1-yl)methyl]spiro[1,3-dioxepane-2,3'-indole]-2'-one |
| SMILES | O=C1N(CN2CCN(C(c3ccccc3)c3ccccc3)CC2)c2ccccc2C12OCCCCO2 |
| InChI | InChI=1S/C30H33N3O3/c34-29-30(35-21-9-10-22-36-30)26-15-7-8-16-27(26)33(29)23-31-17-19-32(20-18-31)28(24-11-3-1-4-12-24)25-13-5-2-6-14-25/h1-8,11-16,28H,9-10,17-23H2 |
| InChIKey | OGHVVYRHCGMGIU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1'-[(4-benzhydrylpiperazin-1-yl)methyl]spiro[1,3-dioxepane-2,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-[(4-benzhydrylpiperazin-1-yl)methyl]spiro[1,3-dioxepane-2,3'-indole]-2'-one?
The IUPAC name of 1'-[(4-benzhydrylpiperazin-1-yl)methyl]spiro[1,3-dioxepane-2,3'-indole]-2'-one (CID 2001450) is 1'-[(4-benzhydrylpiperazin-1-yl)methyl]spiro[1,3-dioxepane-2,3'-indole]-2'-one.
What is the SMILES notation for 1'-[(4-benzhydrylpiperazin-1-yl)methyl]spiro[1,3-dioxepane-2,3'-indole]-2'-one?
The canonical SMILES for 1'-[(4-benzhydrylpiperazin-1-yl)methyl]spiro[1,3-dioxepane-2,3'-indole]-2'-one is O=C1N(CN2CCN(C(c3ccccc3)c3ccccc3)CC2)c2ccccc2C12OCCCCO2.
What is the InChIKey of 1'-[(4-benzhydrylpiperazin-1-yl)methyl]spiro[1,3-dioxepane-2,3'-indole]-2'-one?
The InChIKey is OGHVVYRHCGMGIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H33N3O3/c34-29-30(35-21-9-10-22-36-30)26-15-7-8-16-27(26)33(29)23-31-17-19-32(20-18-31)28(24-11-3-1-4-12-24)25-13-5-2-6-14-25/h1-8,11-16,28H,9-10,17-23H2.
What are the key properties of 1'-[(4-benzhydrylpiperazin-1-yl)methyl]spiro[1,3-dioxepane-2,3'-indole]-2'-one?
1'-[(4-benzhydrylpiperazin-1-yl)methyl]spiro[1,3-dioxepane-2,3'-indole]-2'-one has a molecular weight of 483.61 g/mol, XLogP of 4.38, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-[(4-benzhydrylpiperazin-1-yl)methyl]spiro[1,3-dioxepane-2,3'-indole]-2'-one is sourced from PubChem (CID 2001450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).