C24H30N3O4+ — CID 7304634
1'-[[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]methyl]spiro[1,3-dioxepane-2,3'-indole]-2'-one (PubChem CID 7304634) has the molecular formula C24H30N3O4+ and a molecular weight of 424.52 g/mol. Its IUPAC name is 1'-[[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]methyl]spiro[1,3-dioxepane-2,3'-indole]-2'-one.
| Compound Name | 1'-[[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]methyl]spiro[1,3-dioxepane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 7304634 |
| Molecular Formula | C24H30N3O4+ |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 1'-[[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]methyl]spiro[1,3-dioxepane-2,3'-indole]-2'-one |
| SMILES | COc1ccc(N2CC[NH+](CN3C(=O)C4(OCCCCO4)c4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C24H29N3O4/c1-29-20-10-8-19(9-11-20)26-14-12-25(13-15-26)18-27-22-7-3-2-6-21(22)24(23(27)28)30-16-4-5-17-31-24/h2-3,6-11H,4-5,12-18H2,1H3/p+1 |
| InChIKey | IHDWOLVTCPSUKV-UHFFFAOYSA-O |
| XLogP | 1.38 |
| TPSA | 55.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|