C24H29NO4 — CID 18884280
1'-[3-(4-tert-butylphenoxy)propyl]spiro[1,3-dioxane-2,3'-indole]-2'-one (PubChem CID 18884280) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is 1'-[3-(4-tert-butylphenoxy)propyl]spiro[1,3-dioxane-2,3'-indole]-2'-one.
| Compound Name | 1'-[3-(4-tert-butylphenoxy)propyl]spiro[1,3-dioxane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 18884280 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 1'-[3-(4-tert-butylphenoxy)propyl]spiro[1,3-dioxane-2,3'-indole]-2'-one |
| SMILES | CC(C)(C)c1ccc(OCCCN2C(=O)C3(OCCCO3)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H29NO4/c1-23(2,3)18-10-12-19(13-11-18)27-15-6-14-25-21-9-5-4-8-20(21)24(22(25)26)28-16-7-17-29-24/h4-5,8-13H,6-7,14-17H2,1-3H3 |
| InChIKey | XHMVGEXBUYIWRT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|