C25H22BrNO6 — CID 132942155
tert-butyl 4-(3-benzoyl-6-bromo-2-oxo-3,4-dihydrochromen-4-yl)-5-oxo-2H-pyrrole-1-carboxylate (PubChem CID 132942155) has the molecular formula C25H22BrNO6 and a molecular weight of 512.36 g/mol. Its IUPAC name is tert-butyl 4-(3-benzoyl-6-bromo-2-oxo-3,4-dihydrochromen-4-yl)-5-oxo-2H-pyrrole-1-carboxylate.
| Compound Name | tert-butyl 4-(3-benzoyl-6-bromo-2-oxo-3,4-dihydrochromen-4-yl)-5-oxo-2H-pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 132942155 |
| Molecular Formula | C25H22BrNO6 |
| Molecular Weight | 512.36 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | tert-butyl 4-(3-benzoyl-6-bromo-2-oxo-3,4-dihydrochromen-4-yl)-5-oxo-2H-pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C(C2c3cc(Br)ccc3OC(=O)C2C(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C25H22BrNO6/c1-25(2,3)33-24(31)27-12-11-16(22(27)29)19-17-13-15(26)9-10-18(17)32-23(30)20(19)21(28)14-7-5-4-6-8-14/h4-11,13,19-20H,12H2,1-3H3 |
| InChIKey | RSQTZMNHPVHPTR-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.36 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|