C15H15N3O4S — CID 96558451
N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-2-[(4R)-2-oxo-3,4-dihydrochromen-4-yl]acetamide (PubChem CID 96558451) has the molecular formula C15H15N3O4S and a molecular weight of 333.37 g/mol. Its IUPAC name is N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-2-[(4R)-2-oxo-3,4-dihydrochromen-4-yl]acetamide.
| Compound Name | N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-2-[(4R)-2-oxo-3,4-dihydrochromen-4-yl]acetamide |
|---|---|
| PubChem CID | 96558451 |
| Molecular Formula | C15H15N3O4S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-2-[(4R)-2-oxo-3,4-dihydrochromen-4-yl]acetamide |
| SMILES | COCc1nnc(NC(=O)C[C@@H]2CC(=O)Oc3ccccc32)s1 |
| InChI | InChI=1S/C15H15N3O4S/c1-21-8-13-17-18-15(23-13)16-12(19)6-9-7-14(20)22-11-5-3-2-4-10(9)11/h2-5,9H,6-8H2,1H3,(H,16,18,19)/t9-/m1/s1 |
| InChIKey | UZXDPKUMBNTOGZ-SECBINFHSA-N |
| XLogP | 2.11 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|