C14H14N4O4S — CID 39069615
N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-2-(2-oxo-3H-1,4-benzoxazin-4-yl)acetamide (PubChem CID 39069615) has the molecular formula C14H14N4O4S and a molecular weight of 334.36 g/mol. Its IUPAC name is N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-2-(2-oxo-3H-1,4-benzoxazin-4-yl)acetamide.
| Compound Name | N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-2-(2-oxo-3H-1,4-benzoxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 39069615 |
| Molecular Formula | C14H14N4O4S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-2-(2-oxo-3H-1,4-benzoxazin-4-yl)acetamide |
| SMILES | COCc1nnc(NC(=O)CN2CC(=O)Oc3ccccc32)s1 |
| InChI | InChI=1S/C14H14N4O4S/c1-21-8-12-16-17-14(23-12)15-11(19)6-18-7-13(20)22-10-5-3-2-4-9(10)18/h2-5H,6-8H2,1H3,(H,15,17,19) |
| InChIKey | YMQVWBLRBHQAFJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|