C16H13FN2O3 — CID 18837565
N-(4-fluorophenyl)-2-(2-oxo-3H-1,4-benzoxazin-4-yl)acetamide (PubChem CID 18837565) has the molecular formula C16H13FN2O3 and a molecular weight of 300.29 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-(2-oxo-3H-1,4-benzoxazin-4-yl)acetamide.
| Compound Name | N-(4-fluorophenyl)-2-(2-oxo-3H-1,4-benzoxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 18837565 |
| Molecular Formula | C16H13FN2O3 |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | N-(4-fluorophenyl)-2-(2-oxo-3H-1,4-benzoxazin-4-yl)acetamide |
| SMILES | O=C(CN1CC(=O)Oc2ccccc21)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C16H13FN2O3/c17-11-5-7-12(8-6-11)18-15(20)9-19-10-16(21)22-14-4-2-1-3-13(14)19/h1-8H,9-10H2,(H,18,20) |
| InChIKey | UGSSOISZTNNNPB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|