C21H23N3O3 — CID 39058916
2-(2-oxo-3H-1,4-benzoxazin-4-yl)-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 39058916) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-(2-oxo-3H-1,4-benzoxazin-4-yl)-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-(2-oxo-3H-1,4-benzoxazin-4-yl)-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 39058916 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 2-(2-oxo-3H-1,4-benzoxazin-4-yl)-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | O=C(CN1CC(=O)Oc2ccccc21)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H23N3O3/c25-20(14-24-15-21(26)27-19-7-3-2-6-18(19)24)22-16-8-10-17(11-9-16)23-12-4-1-5-13-23/h2-3,6-11H,1,4-5,12-15H2,(H,22,25) |
| InChIKey | GCIHLBBSQABLOD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|