C21H24N4O3 — CID 39058913
N-[4-(4-methylpiperazin-1-yl)phenyl]-2-(2-oxo-3H-1,4-benzoxazin-4-yl)acetamide (PubChem CID 39058913) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-2-(2-oxo-3H-1,4-benzoxazin-4-yl)acetamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-2-(2-oxo-3H-1,4-benzoxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 39058913 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-2-(2-oxo-3H-1,4-benzoxazin-4-yl)acetamide |
| SMILES | CN1CCN(c2ccc(NC(=O)CN3CC(=O)Oc4ccccc43)cc2)CC1 |
| InChI | InChI=1S/C21H24N4O3/c1-23-10-12-24(13-11-23)17-8-6-16(7-9-17)22-20(26)14-25-15-21(27)28-19-5-3-2-4-18(19)25/h2-9H,10-15H2,1H3,(H,22,26) |
| InChIKey | IVPCNZACTFQJJD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|