C17H24N4O3 — CID 110862537
N-[4-(4-methylpiperazin-1-yl)phenyl]-2-(2-oxo-1,3-oxazinan-3-yl)acetamide (PubChem CID 110862537) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-2-(2-oxo-1,3-oxazinan-3-yl)acetamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-2-(2-oxo-1,3-oxazinan-3-yl)acetamide |
|---|---|
| PubChem CID | 110862537 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-2-(2-oxo-1,3-oxazinan-3-yl)acetamide |
| SMILES | CN1CCN(c2ccc(NC(=O)CN3CCCOC3=O)cc2)CC1 |
| InChI | InChI=1S/C17H24N4O3/c1-19-8-10-20(11-9-19)15-5-3-14(4-6-15)18-16(22)13-21-7-2-12-24-17(21)23/h3-6H,2,7-13H2,1H3,(H,18,22) |
| InChIKey | DHNOQCOHTHXOSF-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|