About 2-(2-oxo-1,3-oxazinan-3-yl)acetohydrazide
2-(2-oxo-1,3-oxazinan-3-yl)acetohydrazide (PubChem CID 130710751) has the molecular formula C6H11N3O3
and a molecular weight of 173.17 g/mol. Its IUPAC name is 2-(2-oxo-1,3-oxazinan-3-yl)acetohydrazide.
Molecular Properties
| Compound Name | 2-(2-oxo-1,3-oxazinan-3-yl)acetohydrazide |
| PubChem CID | 130710751 |
| Molecular Formula | C6H11N3O3 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 2-(2-oxo-1,3-oxazinan-3-yl)acetohydrazide |
| SMILES | NNC(=O)CN1CCCOC1=O |
| InChI | InChI=1S/C6H11N3O3/c7-8-5(10)4-9-2-1-3-12-6(9)11/h1-4,7H2,(H,8,10) |
| InChIKey | DCCVNERIVPUZHO-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-oxo-1,3-oxazinan-3-yl)acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-oxo-1,3-oxazinan-3-yl)acetohydrazide?
The IUPAC name of 2-(2-oxo-1,3-oxazinan-3-yl)acetohydrazide (CID 130710751) is 2-(2-oxo-1,3-oxazinan-3-yl)acetohydrazide.
What is the SMILES notation for 2-(2-oxo-1,3-oxazinan-3-yl)acetohydrazide?
The canonical SMILES for 2-(2-oxo-1,3-oxazinan-3-yl)acetohydrazide is NNC(=O)CN1CCCOC1=O.
What is the InChIKey of 2-(2-oxo-1,3-oxazinan-3-yl)acetohydrazide?
The InChIKey is DCCVNERIVPUZHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O3/c7-8-5(10)4-9-2-1-3-12-6(9)11/h1-4,7H2,(H,8,10).
What are the key properties of 2-(2-oxo-1,3-oxazinan-3-yl)acetohydrazide?
2-(2-oxo-1,3-oxazinan-3-yl)acetohydrazide has a molecular weight of 173.17 g/mol, XLogP of -1.18, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-oxo-1,3-oxazinan-3-yl)acetohydrazide is sourced from PubChem (CID 130710751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).