C16H21N3O4 — CID 110862426
N-(2-morpholin-4-ylphenyl)-2-(2-oxo-1,3-oxazinan-3-yl)acetamide (PubChem CID 110862426) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is N-(2-morpholin-4-ylphenyl)-2-(2-oxo-1,3-oxazinan-3-yl)acetamide.
| Compound Name | N-(2-morpholin-4-ylphenyl)-2-(2-oxo-1,3-oxazinan-3-yl)acetamide |
|---|---|
| PubChem CID | 110862426 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | N-(2-morpholin-4-ylphenyl)-2-(2-oxo-1,3-oxazinan-3-yl)acetamide |
| SMILES | O=C(CN1CCCOC1=O)Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C16H21N3O4/c20-15(12-19-6-3-9-23-16(19)21)17-13-4-1-2-5-14(13)18-7-10-22-11-8-18/h1-2,4-5H,3,6-12H2,(H,17,20) |
| InChIKey | JUGDKYQSBMBKKU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |