C13H13F3N2O3 — CID 110860875
2-(2-oxo-1,3-oxazinan-3-yl)-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 110860875) has the molecular formula C13H13F3N2O3 and a molecular weight of 302.25 g/mol. Its IUPAC name is 2-(2-oxo-1,3-oxazinan-3-yl)-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(2-oxo-1,3-oxazinan-3-yl)-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 110860875 |
| Molecular Formula | C13H13F3N2O3 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-(2-oxo-1,3-oxazinan-3-yl)-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1CCCOC1=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F3N2O3/c14-13(15,16)9-3-1-4-10(7-9)17-11(19)8-18-5-2-6-21-12(18)20/h1,3-4,7H,2,5-6,8H2,(H,17,19) |
| InChIKey | XWANPPXGVDPGGU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |