C20H17F4N3O3 — CID 53063668
2-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 53063668) has the molecular formula C20H17F4N3O3 and a molecular weight of 423.37 g/mol. Its IUPAC name is 2-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 53063668 |
| Molecular Formula | C20H17F4N3O3 |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 2-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1CCN(Cc2ccc(F)cc2)C(=O)C1=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H17F4N3O3/c21-15-6-4-13(5-7-15)11-26-8-9-27(19(30)18(26)29)12-17(28)25-16-3-1-2-14(10-16)20(22,23)24/h1-7,10H,8-9,11-12H2,(H,25,28) |
| InChIKey | YYSCYSKQPFZUHI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|