C22H21F4N3O3 — CID 95067131
(2R)-2-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]-N-[3-(trifluoromethyl)phenyl]butanamide (PubChem CID 95067131) has the molecular formula C22H21F4N3O3 and a molecular weight of 451.42 g/mol. Its IUPAC name is (2R)-2-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]-N-[3-(trifluoromethyl)phenyl]butanamide.
| Compound Name | (2R)-2-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]-N-[3-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 95067131 |
| Molecular Formula | C22H21F4N3O3 |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | (2R)-2-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]-N-[3-(trifluoromethyl)phenyl]butanamide |
| SMILES | CC[C@H](C(=O)Nc1cccc(C(F)(F)F)c1)N1CCN(Cc2ccc(F)cc2)C(=O)C1=O |
| InChI | InChI=1S/C22H21F4N3O3/c1-2-18(19(30)27-17-5-3-4-15(12-17)22(24,25)26)29-11-10-28(20(31)21(29)32)13-14-6-8-16(23)9-7-14/h3-9,12,18H,2,10-11,13H2,1H3,(H,27,30)/t18-/m1/s1 |
| InChIKey | HPKRZIUXIALZJG-GOSISDBHSA-N |
| XLogP | 3.43 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|