C23H26FN3O4 — CID 93056412
(2R)-N-(4-ethoxyphenyl)-2-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]butanamide (PubChem CID 93056412) has the molecular formula C23H26FN3O4 and a molecular weight of 427.48 g/mol. Its IUPAC name is (2R)-N-(4-ethoxyphenyl)-2-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]butanamide.
| Compound Name | (2R)-N-(4-ethoxyphenyl)-2-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]butanamide |
|---|---|
| PubChem CID | 93056412 |
| Molecular Formula | C23H26FN3O4 |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | (2R)-N-(4-ethoxyphenyl)-2-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]butanamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H](CC)N2CCN(Cc3ccc(F)cc3)C(=O)C2=O)cc1 |
| InChI | InChI=1S/C23H26FN3O4/c1-3-20(21(28)25-18-9-11-19(12-10-18)31-4-2)27-14-13-26(22(29)23(27)30)15-16-5-7-17(24)8-6-16/h5-12,20H,3-4,13-15H2,1-2H3,(H,25,28)/t20-/m1/s1 |
| InChIKey | TXNSXRVKYOVVEZ-HXUWFJFHSA-N |
| XLogP | 2.81 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|