C22H23ClFN3O3 — CID 93056425
(2S)-N-(3-chloro-2-methylphenyl)-2-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]butanamide (PubChem CID 93056425) has the molecular formula C22H23ClFN3O3 and a molecular weight of 431.90 g/mol. Its IUPAC name is (2S)-N-(3-chloro-2-methylphenyl)-2-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]butanamide.
| Compound Name | (2S)-N-(3-chloro-2-methylphenyl)-2-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]butanamide |
|---|---|
| PubChem CID | 93056425 |
| Molecular Formula | C22H23ClFN3O3 |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | (2S)-N-(3-chloro-2-methylphenyl)-2-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]butanamide |
| SMILES | CC[C@@H](C(=O)Nc1cccc(Cl)c1C)N1CCN(Cc2ccc(F)cc2)C(=O)C1=O |
| InChI | InChI=1S/C22H23ClFN3O3/c1-3-19(20(28)25-18-6-4-5-17(23)14(18)2)27-12-11-26(21(29)22(27)30)13-15-7-9-16(24)10-8-15/h4-10,19H,3,11-13H2,1-2H3,(H,25,28)/t19-/m0/s1 |
| InChIKey | XKFDOKFNBFOMRJ-IBGZPJMESA-N |
| XLogP | 3.38 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|