C23H33FN4O3 — CID 53005723
2-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]-N-(3-piperidin-1-ylpropyl)butanamide (PubChem CID 53005723) has the molecular formula C23H33FN4O3 and a molecular weight of 432.54 g/mol. Its IUPAC name is 2-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]-N-(3-piperidin-1-ylpropyl)butanamide.
| Compound Name | 2-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]-N-(3-piperidin-1-ylpropyl)butanamide |
|---|---|
| PubChem CID | 53005723 |
| Molecular Formula | C23H33FN4O3 |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 2-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]-N-(3-piperidin-1-ylpropyl)butanamide |
| SMILES | CCC(C(=O)NCCCN1CCCCC1)N1CCN(Cc2ccc(F)cc2)C(=O)C1=O |
| InChI | InChI=1S/C23H33FN4O3/c1-2-20(21(29)25-11-6-14-26-12-4-3-5-13-26)28-16-15-27(22(30)23(28)31)17-18-7-9-19(24)10-8-18/h7-10,20H,2-6,11-17H2,1H3,(H,25,29) |
| InChIKey | QOOKMHZDORLISH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|