C19H26FN3O4 — CID 53005720
2-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]-N-(3-methoxypropyl)butanamide (PubChem CID 53005720) has the molecular formula C19H26FN3O4 and a molecular weight of 379.43 g/mol. Its IUPAC name is 2-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]-N-(3-methoxypropyl)butanamide.
| Compound Name | 2-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]-N-(3-methoxypropyl)butanamide |
|---|---|
| PubChem CID | 53005720 |
| Molecular Formula | C19H26FN3O4 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 2-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]-N-(3-methoxypropyl)butanamide |
| SMILES | CCC(C(=O)NCCCOC)N1CCN(Cc2ccc(F)cc2)C(=O)C1=O |
| InChI | InChI=1S/C19H26FN3O4/c1-3-16(17(24)21-9-4-12-27-2)23-11-10-22(18(25)19(23)26)13-14-5-7-15(20)8-6-14/h5-8,16H,3-4,9-13H2,1-2H3,(H,21,24) |
| InChIKey | IKBKDIILTDTCEM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|