C20H32N4O — CID 109006402
2-(2-ethylpiperidin-1-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide (PubChem CID 109006402) has the molecular formula C20H32N4O and a molecular weight of 344.50 g/mol. Its IUPAC name is 2-(2-ethylpiperidin-1-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-(2-ethylpiperidin-1-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 109006402 |
| Molecular Formula | C20H32N4O |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | 2-(2-ethylpiperidin-1-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide |
| SMILES | CCC1CCCCN1CC(=O)Nc1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C20H32N4O/c1-3-18-6-4-5-11-24(18)16-20(25)21-17-7-9-19(10-8-17)23-14-12-22(2)13-15-23/h7-10,18H,3-6,11-16H2,1-2H3,(H,21,25) |
| InChIKey | TZZRVFRDGWVTAG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|