C15H20F2N2O — CID 42999278
N-(3,4-difluorophenyl)-2-(2-ethylpiperidin-1-yl)acetamide (PubChem CID 42999278) has the molecular formula C15H20F2N2O and a molecular weight of 282.33 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-(2-ethylpiperidin-1-yl)acetamide.
| Compound Name | N-(3,4-difluorophenyl)-2-(2-ethylpiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 42999278 |
| Molecular Formula | C15H20F2N2O |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-(2-ethylpiperidin-1-yl)acetamide |
| SMILES | CCC1CCCCN1CC(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H20F2N2O/c1-2-12-5-3-4-8-19(12)10-15(20)18-11-6-7-13(16)14(17)9-11/h6-7,9,12H,2-5,8,10H2,1H3,(H,18,20) |
| InChIKey | SWWUWWUKZISGAJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |