C18H16N2O5 — CID 39058834
methyl 2-[[2-(2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]benzoate (PubChem CID 39058834) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is methyl 2-[[2-(2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-(2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 39058834 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | methyl 2-[[2-(2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)CN1CC(=O)Oc2ccccc21 |
| InChI | InChI=1S/C18H16N2O5/c1-24-18(23)12-6-2-3-7-13(12)19-16(21)10-20-11-17(22)25-15-9-5-4-8-14(15)20/h2-9H,10-11H2,1H3,(H,19,21) |
| InChIKey | RGXSIRPDHJKLPI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|