C17H22N2O4 — CID 97263755
N-(2-morpholin-4-ylethyl)-2-[(4R)-2-oxo-3,4-dihydrochromen-4-yl]acetamide (PubChem CID 97263755) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-2-[(4R)-2-oxo-3,4-dihydrochromen-4-yl]acetamide.
| Compound Name | N-(2-morpholin-4-ylethyl)-2-[(4R)-2-oxo-3,4-dihydrochromen-4-yl]acetamide |
|---|---|
| PubChem CID | 97263755 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-2-[(4R)-2-oxo-3,4-dihydrochromen-4-yl]acetamide |
| SMILES | O=C(C[C@@H]1CC(=O)Oc2ccccc21)NCCN1CCOCC1 |
| InChI | InChI=1S/C17H22N2O4/c20-16(18-5-6-19-7-9-22-10-8-19)11-13-12-17(21)23-15-4-2-1-3-14(13)15/h1-4,13H,5-12H2,(H,18,20)/t13-/m1/s1 |
| InChIKey | AGLQIDHTKFBKBA-CYBMUJFWSA-N |
| XLogP | 0.92 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|