C18H24N2O5 — CID 58265158
2-(7-hydroxy-2-oxo-3,4-dihydrochromen-4-yl)-N-(3-morpholin-4-ylpropyl)acetamide (PubChem CID 58265158) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-(7-hydroxy-2-oxo-3,4-dihydrochromen-4-yl)-N-(3-morpholin-4-ylpropyl)acetamide.
| Compound Name | 2-(7-hydroxy-2-oxo-3,4-dihydrochromen-4-yl)-N-(3-morpholin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 58265158 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-(7-hydroxy-2-oxo-3,4-dihydrochromen-4-yl)-N-(3-morpholin-4-ylpropyl)acetamide |
| SMILES | O=C(CC1CC(=O)Oc2cc(O)ccc21)NCCCN1CCOCC1 |
| InChI | InChI=1S/C18H24N2O5/c21-14-2-3-15-13(11-18(23)25-16(15)12-14)10-17(22)19-4-1-5-20-6-8-24-9-7-20/h2-3,12-13,21H,1,4-11H2,(H,19,22) |
| InChIKey | UYOUDIFOZTZUND-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|