C24H23N2O5- — CID 7309915
(1R,6R)-3,4-dimethyl-6-[(9H-xanthene-9-carbonylamino)carbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 7309915) has the molecular formula C24H23N2O5- and a molecular weight of 419.46 g/mol. Its IUPAC name is (1R,6R)-3,4-dimethyl-6-[(9H-xanthene-9-carbonylamino)carbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | (1R,6R)-3,4-dimethyl-6-[(9H-xanthene-9-carbonylamino)carbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7309915 |
| Molecular Formula | C24H23N2O5- |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | (1R,6R)-3,4-dimethyl-6-[(9H-xanthene-9-carbonylamino)carbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | CC1=C(C)C[C@@H](C(=O)NNC(=O)C2c3ccccc3Oc3ccccc32)[C@H](C(=O)[O-])C1 |
| InChI | InChI=1S/C24H24N2O5/c1-13-11-17(18(24(29)30)12-14(13)2)22(27)25-26-23(28)21-15-7-3-5-9-19(15)31-20-10-6-4-8-16(20)21/h3-10,17-18,21H,11-12H2,1-2H3,(H,25,27)(H,26,28)(H,29,30)/p-1/t17-,18-/m1/s1 |
| InChIKey | OFKBFRUITMTUQP-QZTJIDSGSA-M |
| XLogP | 2.18 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|