C20H17N3O3S — CID 2209096
1-(furan-2-ylmethyl)-3-(9H-xanthene-9-carbonylamino)thiourea (PubChem CID 2209096) has the molecular formula C20H17N3O3S and a molecular weight of 379.44 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-(9H-xanthene-9-carbonylamino)thiourea.
| Compound Name | 1-(furan-2-ylmethyl)-3-(9H-xanthene-9-carbonylamino)thiourea |
|---|---|
| PubChem CID | 2209096 |
| Molecular Formula | C20H17N3O3S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-(9H-xanthene-9-carbonylamino)thiourea |
| SMILES | O=C(NNC(=S)NCc1ccco1)C1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C20H17N3O3S/c24-19(22-23-20(27)21-12-13-6-5-11-25-13)18-14-7-1-3-9-16(14)26-17-10-4-2-8-15(17)18/h1-11,18H,12H2,(H,22,24)(H2,21,23,27) |
| InChIKey | XRNUEBHGUHVCSI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 75.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|