C14H14FN3O2S2 — CID 8786927
1-[[2-(2-fluorophenyl)sulfanylacetyl]amino]-3-(furan-2-ylmethyl)thiourea (PubChem CID 8786927) has the molecular formula C14H14FN3O2S2 and a molecular weight of 339.42 g/mol. Its IUPAC name is 1-[[2-(2-fluorophenyl)sulfanylacetyl]amino]-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-[[2-(2-fluorophenyl)sulfanylacetyl]amino]-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 8786927 |
| Molecular Formula | C14H14FN3O2S2 |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 1-[[2-(2-fluorophenyl)sulfanylacetyl]amino]-3-(furan-2-ylmethyl)thiourea |
| SMILES | O=C(CSc1ccccc1F)NNC(=S)NCc1ccco1 |
| InChI | InChI=1S/C14H14FN3O2S2/c15-11-5-1-2-6-12(11)22-9-13(19)17-18-14(21)16-8-10-4-3-7-20-10/h1-7H,8-9H2,(H,17,19)(H2,16,18,21) |
| InChIKey | GCEURURTMQNYPC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|